Difference between revisions of "CPD-7418"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-D2-ENOYL-COA CIS-D2-ENOYL-COA] == * common name: ** a cis-2-enoyl-CoA * Synonym(s): ** a ci...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == * smiles: ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] * inchi key: ** InChIKey=PMOW...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7418 CPD-7418] == |
+ | * smiles: | ||
+ | ** C(C=CC1(=C(C=CC=C1)O))(=O)[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=PMOWTIHVNWZYFI-WAYWQWQTSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** coumarinate |
+ | * molecular weight: | ||
+ | ** 163.152 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** coumarinic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8037]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8036]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54714352 54714352] |
− | {{#set: | + | * HMDB : HMDB41592 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05838 C05838] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.20118034.html 20118034] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47921 47921] | ||
+ | * METABOLIGHTS : MTBLC47921 | ||
+ | {{#set: smiles=C(C=CC1(=C(C=CC=C1)O))(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=PMOWTIHVNWZYFI-WAYWQWQTSA-M}} | ||
+ | {{#set: common name=coumarinate}} | ||
+ | {{#set: molecular weight=163.152 }} | ||
+ | {{#set: common name=coumarinic acid}} | ||
+ | {{#set: consumed by=RXN-8037}} | ||
+ | {{#set: produced by=RXN-8036}} |
Latest revision as of 20:06, 21 March 2018
Contents
Metabolite CPD-7418
- smiles:
- C(C=CC1(=C(C=CC=C1)O))(=O)[O-]
- inchi key:
- InChIKey=PMOWTIHVNWZYFI-WAYWQWQTSA-M
- common name:
- coumarinate
- molecular weight:
- 163.152
- Synonym(s):
- coumarinic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB41592
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC47921
"C(C=CC1(=C(C=CC=C1)O))(=O)[O-" cannot be used as a page name in this wiki.