Difference between revisions of "CIS-D2-ENOYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-D2-ENOYL-COA CIS-D2-ENOYL-COA] == * common name: ** a cis-2-enoyl-CoA * Synonym(s): ** a ci...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-D2-ENOYL-COA CIS-D2-ENOYL-COA] ==
* smiles:
+
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
+
* inchi key:
+
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
** bisorganyltrisulfane
+
** a cis-2-enoyl-CoA
* molecular weight:
+
** 644.686   
+
 
* Synonym(s):
 
* Synonym(s):
** GS3G
+
** a cis-2,3-dehydroacyl-CoA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-10851]]
+
* [[RXN-17475]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a cis-2-enoyl-CoA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
+
{{#set: common name=a cis-2,3-dehydroacyl-CoA}}
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
+
{{#set: reversible reaction associated=RXN-17475}}
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
+
{{#set: common name=bisorganyltrisulfane}}
+
{{#set: molecular weight=644.686    }}
+
{{#set: common name=GS3G}}
+
{{#set: reversible reaction associated=RXN-10851}}
+

Latest revision as of 19:07, 21 March 2018

Metabolite CIS-D2-ENOYL-COA

  • common name:
    • a cis-2-enoyl-CoA
  • Synonym(s):
    • a cis-2,3-dehydroacyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links