Difference between revisions of "RXN1G-1053"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] == * smiles: ** CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1053 RXN1G-1053] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta19-3-oxo-C38:1-[...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1053 RXN1G-1053] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ULOGSHZMDLRQRY-INBGBNCRSA-J
+
 
* common name:
 
* common name:
−
** 2-trans,4-trans-tetradecadienoyl-CoA
+
** cis-delta19-3-oxo-C38:1-[acyl-carrier protein] reductase
−
* molecular weight:
+
* ec number:
−
** 969.83   
+
** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14715]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[cis-delta19-3-oxo-C38-ACPs]][c] '''=>''' 1 [[cis-delta19-3-hydroxyC38-ACPs]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a cis-delta19-3-oxo-C38:1-[acp][c] '''=>''' 1 a cis-delta19-3-hydroxyC38:1-[acp][c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''30''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659084 90659084]
+
{{#set: common name=cis-delta19-3-oxo-C38:1-[acyl-carrier protein] reductase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.1.1.M9}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87712 87712]
+
{{#set: in pathway=PWYG-321}}
−
{{#set: smiles=CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=ULOGSHZMDLRQRY-INBGBNCRSA-J}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=2-trans,4-trans-tetradecadienoyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=969.83    }}
+
−
{{#set: consumed by=RXN-14715}}
+

Latest revision as of 19:08, 21 March 2018

Reaction RXN1G-1053

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis-delta19-3-oxo-C38:1-[acyl-carrier protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 30 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis-delta19-3-oxo-C38:1-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN1G-1053&oldid=24771"