Difference between revisions of "PWY-5947"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5947 PWY-5947] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5947 PWY-5947] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
* common name: | * common name: | ||
− | ** | + | ** lutein biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
− | * [[ | + | * [[RXN1F-148]] |
− | + | ** 7 associated gene(s): | |
− | * [[ | + | *** [[Ec-07_007260]] |
− | * [[ | + | *** [[Ec-00_005820]] |
− | * [[ | + | *** [[Ec-02_005510]] |
− | * [[ | + | *** [[Ec-24_002140]] |
− | == Reaction(s) | + | *** [[Ec-24_002150]] |
− | * [ | + | *** [[Ec-00_005850]] |
− | + | *** [[Ec-10_006240]] | |
− | * [ | + | ** 1 reconstruction source(s) associated: |
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5961 RXN-5961] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-5962 RXN-5962] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-2763}} | |
− | + | {{#set: taxonomic range=TAX-3041}} | |
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=lutein biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=33.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:09, 21 March 2018
Pathway PWY-5947
- taxonomic range:
- common name:
- lutein biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN1F-148
- 7 associated gene(s):
- 1 reconstruction source(s) associated: