Difference between revisions of "RXN-113"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
(Created page with "Category:Gene == Gene Ec-09_000200 == * left end position: ** 205406 * transcription direction: ** NEGATIVE * right end position: ** 230032 * centisome position: ** 3.6593...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-09_000200 == |
− | * | + | * left end position: |
− | ** | + | ** 205406 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 230032 |
− | * | + | * centisome position: |
− | ** | + | ** 3.6593642 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0215_0037 |
− | ** | + | ** Esi0215_0037 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.4.21.4-RXN]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | + | *** Assignment: automated-name-match | |
− | == | + | == Pathways associated == |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=205406}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=230032}} | |
− | + | {{#set: centisome position=3.6593642 }} | |
− | + | {{#set: common name=Esi_0215_0037|Esi0215_0037}} | |
− | + | {{#set: reaction associated=3.4.21.4-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:18, 21 March 2018
Gene Ec-09_000200
- left end position:
- 205406
- transcription direction:
- NEGATIVE
- right end position:
- 230032
- centisome position:
- 3.6593642
- Synonym(s):
- Esi_0215_0037
- Esi0215_0037
Reactions associated
- Reaction: 3.4.21.4-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome