Difference between revisions of "Ec-21 003270"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...")
(Created page with "Category:Gene == Gene Ec-22_002360 == * left end position: ** 2640503 * transcription direction: ** POSITIVE * right end position: ** 2650218 * centisome position: ** 58.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
+
== Gene Ec-22_002360 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
+
** 2640503
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4α-methyl-5α-cholesta-8-en-3-one
+
** 2650218
−
* molecular weight:
+
* centisome position:
−
** 398.671    
+
** 58.47188    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0091_0008
 +
** Esi0091_0008
 +
** EIF3e
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.4.25.1-RXN]]
−
* [[RXN66-18]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2640503}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202835 25202835]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB12174
+
{{#set: right end position=2650218}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}}
+
{{#set: centisome position=58.47188    }}
−
{{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}}
+
{{#set: common name=Esi_0091_0008|Esi0091_0008|EIF3e}}
−
{{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}}
+
{{#set: reaction associated=3.4.25.1-RXN}}
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: produced by=RXN66-18}}
+

Revision as of 13:22, 21 March 2018

Gene Ec-22_002360

  • left end position:
    • 2640503
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2650218
  • centisome position:
    • 58.47188
  • Synonym(s):
    • Esi_0091_0008
    • Esi0091_0008
    • EIF3e

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_003270&oldid=17996"