Difference between revisions of "Ec-06 001640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.27.9-RXN 3.1.27.9-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** tRNA-splicing endonuc...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.27.9-RXN 3.1.27.9-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
 +
* inchi key:
 +
** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
 
* common name:
 
* common name:
−
** tRNA-splicing endonuclease subunit Sen15
+
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.6.1.16 EC-4.6.1.16]
+
** 266.253   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15680]]
−
** 1 [[CPD0-2350]][c] '''=>''' 1 [[Pre-tRNA-5-prime-half-molecules]][c] '''+''' 1 [[tRNA-Introns]][c] '''+''' 1 [[Pre-tRNA-3-prime-half-molecules]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a polycistronic tRNA precursor[c] '''=>''' 1 a 5' half-tRNA molecule with a 2',3' cyclic phosphate on its 3' end[c] '''+''' 1 a tRNA intron with a 2',3'-cyclic phosphate and a 5'-hydroxyl terminus[c] '''+''' 1 a 3' half-tRNA molecule with a hydroxyl on its 5' end[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-21_006500]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-6689]], tRNA splicing: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6689 PWY-6689]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* UNIPROT:
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/O07118 O07118]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}}
−
{{#set: common name=tRNA-splicing endonuclease subunit Sen15}}
+
{{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}}
−
{{#set: ec number=EC-4.6.1.16}}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
−
{{#set: gene associated=Ec-21_006500}}
+
{{#set: molecular weight=266.253    }}
−
{{#set: in pathway=PWY-6689}}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=RXN-15680}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Revision as of 13:22, 21 March 2018

Metabolite CPD-17045

  • smiles:
    • C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
  • inchi key:
    • InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
  • common name:
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
  • molecular weight:
    • 266.253
  • Synonym(s):
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_001640&oldid=18018"