Difference between revisions of "3.4.21.4-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] == * smiles: ** CC(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=AYFVYJQAPQTCCC-GBXIJSLD...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THR THR] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511] ==
−
* smiles:
+
* taxonomic range:
−
** CC(O)C([N+])C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
−
** InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N
+
 
* common name:
 
* common name:
−
** L-threonine
+
** protein ubiquitylation
−
* molecular weight:
+
−
** 119.12   
+
 
* Synonym(s):
 
* Synonym(s):
−
** T
 
−
** thr
 
−
** thre
 
−
** L-thr
 
−
** threonine
 
−
** 2-amino-3-hydroxybutyric acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[biomass_rxn]]
+
'''9''' reactions found over '''9''' reactions in the full pathway
−
* [[THREONINE--TRNA-LIGASE-RXN]]
+
* [[RXN-15556]]
−
* [[THREDEHYD-RXN]]
+
** 14 associated gene(s):
−
* [[THREONINE-ALDOLASE-RXN]]
+
*** [[Ec-13_002970]]
−
* [[RXN-15122]]
+
*** [[Ec-14_005080]]
−
== Reaction(s) known to produce the compound ==
+
*** [[Ec-10_003200]]
−
* [[THRESYN-RXN]]
+
*** [[Ec-08_003600]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-08_005090]]
−
* [[RXN-14569]]
+
*** [[Ec-28_000490]]
 +
*** [[Ec-26_004480]]
 +
*** [[Ec-12_005810]]
 +
*** [[Ec-08_005320]]
 +
*** [[Ec-09_003260]]
 +
*** [[Ec-00_001460]]
 +
*** [[Ec-09_004750]]
 +
*** [[Ec-08_002220]]
 +
*** [[Ec-16_005210]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15559]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15560]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15561]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15563]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-15564]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16313]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-16314]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** 25 associated gene(s):
 +
*** [[Ec-09_004750]]
 +
*** [[Ec-13_002660]]
 +
*** [[Ec-01_007490]]
 +
*** [[Ec-26_001140]]
 +
*** [[Ec-22_002200]]
 +
*** [[Ec-01_008900]]
 +
*** [[Ec-01_009550]]
 +
*** [[Ec-06_002450]]
 +
*** [[Ec-25_000510]]
 +
*** [[Ec-25_002490]]
 +
*** [[Ec-18_001830]]
 +
*** [[Ec-01_001660]]
 +
*** [[Ec-14_006720]]
 +
*** [[Ec-25_000920]]
 +
*** [[Ec-14_003730]]
 +
*** [[Ec-00_007160]]
 +
*** [[Ec-25_000910]]
 +
*** [[Ec-09_000720]]
 +
*** [[Ec-14_001990]]
 +
*** [[Ec-25_002630]]
 +
*** [[Ec-27_002840]]
 +
*** [[Ec-01_010570]]
 +
*** [[Ec-16_001360]]
 +
*** [[Ec-24_003940]]
 +
*** [[Ec-12_000320]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 72-19-5
+
{{#set: taxonomic range=TAX-2759}}
−
* BIGG : 34186
+
{{#set: common name=protein ubiquitylation}}
−
* PUBCHEM:
+
{{#set: reaction found=9}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971019 6971019]
+
{{#set: total reaction=9}}
−
* HMDB : HMDB00167
+
{{#set: completion rate=100.0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00188 C00188]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57926 57926]
+
−
* METABOLIGHTS : MTBLC57926
+
−
{{#set: smiles=CC(O)C([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=AYFVYJQAPQTCCC-GBXIJSLDSA-N}}
+
−
{{#set: common name=L-threonine}}
+
−
{{#set: molecular weight=119.12    }}
+
−
{{#set: common name=T|thr|thre|L-thr|threonine|2-amino-3-hydroxybutyric acid}}
+
−
{{#set: consumed by=biomass_rxn|THREONINE--TRNA-LIGASE-RXN|THREDEHYD-RXN|THREONINE-ALDOLASE-RXN|RXN-15122}}
+
−
{{#set: produced by=THRESYN-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14569}}
+

Revision as of 13:27, 21 March 2018

Pathway PWY-7511

  • taxonomic range:
  • common name:
    • protein ubiquitylation
  • Synonym(s):

Reaction(s) found

9 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3.4.21.4-RXN&oldid=18725"