Difference between revisions of "Protein-N-terminal-L-Arginine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
(Created page with "Category:Gene == Gene Ec-08_006600 == * left end position: ** 6581154 * transcription direction: ** POSITIVE * right end position: ** 6583463 * centisome position: ** 98.2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] ==
+
== Gene Ec-08_006600 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 6581154
−
* common name:
+
* transcription direction:
−
** chlorophyll a
+
** POSITIVE
−
* molecular weight:
+
* right end position:
−
** 892.495    
+
** 6583463
 +
* centisome position:
 +
** 98.26921    
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyll a (phytol)
+
** Esi_0005_0023
 +
** Esi0005_0023
 +
** NCAIR mutase
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[AIRCARBOXY-RXN]]
−
* [[RXN-17428]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-7666]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-6124]]
 
== External links  ==
 
== External links  ==
−
* CAS : 479-61-8
+
{{#set: left end position=6581154}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657767 90657767]
+
{{#set: right end position=6583463}}
−
* KNAPSACK : C00001528
+
{{#set: centisome position=98.26921   }}
−
* HMDB : HMDB38578
+
{{#set: common name=Esi_0005_0023|Esi0005_0023|NCAIR mutase}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=AIRCARBOXY-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05306 C05306]
+
{{#set: pathway associated=PWY-6124}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58416 58416]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=chlorophyll a}}
+
−
{{#set: molecular weight=892.495   }}
+
−
{{#set: common name=chlorophyll a (phytol)}}
+
−
{{#set: produced by=RXN-17428|RXN-7666}}
+

Revision as of 13:30, 21 March 2018

Gene Ec-08_006600

  • left end position:
    • 6581154
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6583463
  • centisome position:
    • 98.26921
  • Synonym(s):
    • Esi_0005_0023
    • Esi0005_0023
    • NCAIR mutase

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Protein-N-terminal-L-Arginine&oldid=19254"