Difference between revisions of "RXN-10720"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C * inchi key...") |
(Created page with "Category:Gene == Gene Ec-03_002030 == * left end position: ** 2470982 * transcription direction: ** NEGATIVE * right end position: ** 2482001 * centisome position: ** 37.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-03_002030 == |
− | * | + | * left end position: |
− | ** | + | ** 2470982 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2482001 |
− | * | + | * centisome position: |
− | ** | + | ** 37.84822 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0011_0150 | ||
+ | ** Esi0011_0150 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GLUC1PURIDYLTRANS-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY-7343]] |
− | + | * [[PWY-3801]] | |
+ | * [[PWY-6527]] | ||
+ | * [[PWY-7238]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2470982}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2482001}} | |
− | + | {{#set: centisome position=37.84822 }} | |
− | + | {{#set: common name=Esi_0011_0150|Esi0011_0150}} | |
− | + | {{#set: reaction associated=GLUC1PURIDYLTRANS-RXN}} | |
− | + | {{#set: pathway associated=PWY-7343|PWY-3801|PWY-6527|PWY-7238}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:31, 21 March 2018
Gene Ec-03_002030
- left end position:
- 2470982
- transcription direction:
- NEGATIVE
- right end position:
- 2482001
- centisome position:
- 37.84822
- Synonym(s):
- Esi_0011_0150
- Esi0011_0150
Reactions associated
- Reaction: GLUC1PURIDYLTRANS-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome