Difference between revisions of "Ec-18 001420"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8892 CPD-8892] == * smiles: ** CCCCCC=CCC=CC=CC=C[CH]1(O[CH]1CCCC(=O)[O-]) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-08_003540 == * left end position: ** 3370807 * transcription direction: ** POSITIVE * right end position: ** 3375321 * centisome position: ** 50.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_003540 == |
− | * | + | * left end position: |
− | ** | + | ** 3370807 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3375321 |
− | * | + | * centisome position: |
− | ** | + | ** 50.332596 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0126_0081 |
− | ** | + | ** Esi0126_0081 |
− | ** | + | ** RPI |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RIB5PISOM-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[P124-PWY]] | ||
+ | * [[CALVIN-PWY]] | ||
+ | * [[PWY-5723]] | ||
+ | * [[PWY-1861]] | ||
+ | * [[P185-PWY]] | ||
+ | * [[NONOXIPENT-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3370807}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3375321}} | |
− | + | {{#set: centisome position=50.332596 }} | |
− | + | {{#set: common name=Esi_0126_0081|Esi0126_0081|RPI}} | |
− | + | {{#set: reaction associated=RIB5PISOM-RXN}} | |
− | + | {{#set: pathway associated=P124-PWY|CALVIN-PWY|PWY-5723|PWY-1861|P185-PWY|NONOXIPENT-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:36, 21 March 2018
Gene Ec-08_003540
- left end position:
- 3370807
- transcription direction:
- POSITIVE
- right end position:
- 3375321
- centisome position:
- 50.332596
- Synonym(s):
- Esi_0126_0081
- Esi0126_0081
- RPI
Reactions associated
- Reaction: RIB5PISOM-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome