Difference between revisions of "ALDHDEHYDROG-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] == * smiles: ** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15068 RXN-15068] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 * ec numbe...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15068 RXN-15068] ==
−
* smiles:
+
* direction:
−
** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M
+
 
* common name:
 
* common name:
−
** cobinamide
+
** phospholipase A2
−
* molecular weight:
+
* ec number:
−
** 990.096   
+
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
 
* Synonym(s):
 
* Synonym(s):
−
** Cbi
 
−
** cobyrinic acid a,c-diamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[BTUR2-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-8268]][c] '''=>''' 1 [[L-1-LYSOPHOSPHATIDATE]][c] '''+''' 1 [[OLEATE-CPD]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 dioleoyl phosphatidate[c] '''=>''' 1 1-oleyl-2-lyso-phosphatidate[c] '''+''' 1 oleate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-04_004650]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-21_005150]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-7417]], phospholipid remodeling (phosphatidate, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7417 PWY-7417]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1867-62-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=phospholipase A2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820010 91820010]
+
{{#set: ec number=EC-3.1.1.4}}
−
* HMDB : HMDB06902
+
{{#set: gene associated=Ec-04_004650|Ec-21_005150}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7417}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05774 C05774]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28956 28956]
+
{{#set: reconstruction tool=pathwaytools}}
−
* BIGG : 46472
+
−
{{#set: smiles=CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))}}
+
−
{{#set: inchi key=InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M}}
+
−
{{#set: common name=cobinamide}}
+
−
{{#set: molecular weight=990.096    }}
+
−
{{#set: common name=Cbi|cobyrinic acid a,c-diamide}}
+
−
{{#set: consumed by=BTUR2-RXN}}
+

Revision as of 13:51, 21 March 2018

Reaction RXN-15068

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phospholipase A2
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7417, phospholipid remodeling (phosphatidate, yeast): PWY-7417
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ALDHDEHYDROG-RXN&oldid=22238"