Difference between revisions of "Ec-07 000620"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] == * smiles: ** COC1(C=C(C=CCO)C=C(OC)C(O)=1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-20_000910 == * Synonym(s): ** Esi_0195_0022 ** Esi0195_0022 == Reactions associated == * Reaction: CTPSYN-RXN ** Source: orthology-aragem...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-20_000910 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0195_0022 | ||
+ | ** Esi0195_0022 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CTPSYN-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-aragem]] |
− | == | + | * Reaction: [[RXN-14325]] |
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7185]] | ||
+ | * [[PWY-7176]] | ||
+ | * [[PWY-7177]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0195_0022|Esi0195_0022}} | |
− | + | {{#set: reaction associated=CTPSYN-RXN|RXN-14325}} | |
− | + | {{#set: pathway associated=PWY-7185|PWY-7176|PWY-7177}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 14:52, 21 March 2018
Gene Ec-20_000910
- Synonym(s):
- Esi_0195_0022
- Esi0195_0022
Reactions associated
- Reaction: CTPSYN-RXN
- Source: orthology-aragem
- Reaction: RXN-14325
- Source: orthology-aragem