Difference between revisions of "SACCHAROPINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-]...")
(Created page with "Category:Gene == Gene Ec-09_000490 == * left end position: ** 568444 * transcription direction: ** NEGATIVE * right end position: ** 577991 * centisome position: ** 10.126...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] ==
+
== Gene Ec-09_000490 ==
* smiles:
+
* left end position:
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O
+
** 568444
* inchi key:
+
* transcription direction:
** InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
+
** NEGATIVE
* common name:
+
* right end position:
** ADP ribose 1'',2''-cyclic phosphate
+
** 577991
* molecular weight:
+
* centisome position:
** 618.26    
+
** 10.126986    
 
* Synonym(s):
 
* Synonym(s):
** ADP ribose 1''-2''-cyclic phosphate
+
** Esi_0135_0041
** ADP ribose 1'',2''-phosphate
+
** Esi0135_0041
** adenosine diphosphate ribose 1'',2''-cyclic phosphate
+
** Appr>p
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12055]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[2.7.1.160-RXN]]
+
*** Assignment: go-term
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=568444}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245989 25245989]
+
{{#set: transcription direction=NEGATIVE}}
* CHEBI:
+
{{#set: right end position=577991}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76596 76596]
+
{{#set: centisome position=10.126986   }}
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O}}
+
{{#set: common name=Esi_0135_0041|Esi0135_0041}}
{{#set: inchi key=InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
{{#set: common name=ADP ribose 1'',2''-cyclic phosphate}}
+
{{#set: molecular weight=618.26   }}
+
{{#set: common name=ADP ribose 1''-2''-cyclic phosphate|ADP ribose 1'',2''-phosphate|adenosine diphosphate ribose 1'',2''-cyclic phosphate|Appr>p}}
+
{{#set: consumed by=RXN-12055}}
+
{{#set: produced by=2.7.1.160-RXN}}
+

Revision as of 13:54, 21 March 2018

Gene Ec-09_000490

  • left end position:
    • 568444
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 577991
  • centisome position:
    • 10.126986
  • Synonym(s):
    • Esi_0135_0041
    • Esi0135_0041

Reactions associated

Pathways associated

External links