Difference between revisions of "Ec-22 000250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * inchi key: ** InChIKey=HMFHBZSHGG...")
(Created page with "Category:Gene == Gene Ec-22_000250 == * left end position: ** 284212 * transcription direction: ** NEGATIVE * right end position: ** 295488 * centisome position: ** 6.2936...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] ==
+
== Gene Ec-22_000250 ==
−
* smiles:
+
* left end position:
−
** C(C1(C(C(C(O1)O)O)O))O
+
** 284212
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** α-D-ribofuranose
+
** 295488
−
* molecular weight:
+
* centisome position:
−
** 150.131    
+
** 6.293653    
 
* Synonym(s):
 
* Synonym(s):
−
** α D-ribose
+
** Esi_0162_0036
 +
** Esi0162_0036
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RIBOKIN-RXN]]
+
* Reaction: [[NAD-KIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
−
* [[RXN-14904]]
+
== Pathways associated ==
 +
* [[PWY-5083]]
 +
* [[NADPHOS-DEPHOS-PWY-1]]
 +
* [[PWY-7268]]
 +
* [[PWY-7269]]
 +
* [[NADPHOS-DEPHOS-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=284212}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=295488}}
−
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575]
+
{{#set: centisome position=6.293653   }}
−
* CHEBI:
+
{{#set: common name=Esi_0162_0036|Esi0162_0036}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506]
+
{{#set: reaction associated=NAD-KIN-RXN}}
−
* HMDB : HMDB00283
+
{{#set: pathway associated=PWY-5083|NADPHOS-DEPHOS-PWY-1|PWY-7268|PWY-7269|NADPHOS-DEPHOS-PWY}}
−
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}}
+
−
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}}
+
−
{{#set: common name=α-D-ribofuranose}}
+
−
{{#set: molecular weight=150.131   }}
+
−
{{#set: common name=α D-ribose}}
+
−
{{#set: consumed by=RIBOKIN-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14904}}
+

Latest revision as of 19:00, 21 March 2018

Gene Ec-22_000250

  • left end position:
    • 284212
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 295488
  • centisome position:
    • 6.293653
  • Synonym(s):
    • Esi_0162_0036
    • Esi0162_0036

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-22_000250&oldid=23806"