Difference between revisions of "RXN-15589"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CATECHOL CATECHOL] == * smiles: ** C1(C=CC(=C(C=1)O)O) * inchi key: ** InChIKey=YCIMNLLNPGFGHC-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15589 RXN-15589] == * direction: ** REVERSIBLE * common name: ** Aryl sulfotransferase ** P-loo...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CATECHOL CATECHOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15589 RXN-15589] ==
−
* smiles:
+
* direction:
−
** C1(C=CC(=C(C=1)O)O)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=YCIMNLLNPGFGHC-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** catechol
+
** Aryl sulfotransferase
−
* molecular weight:
+
** P-loop containing nucleoside triphosphate hydrolase
−
** 110.112   
+
** Sulfotransferase domain
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.8.2.1 EC-2.8.2.1]
 
* Synonym(s):
 
* Synonym(s):
−
** pyrocatechol
 
−
** 2-hydroxyphenol
 
−
** pyrocatechin
 
−
** 1,2-dihydroxybenzene
 
−
** 1,2-benzenediol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-3661]]
+
** 1 [[CPD-14115]][c] '''+''' 1 [[PAPS]][c] '''<=>''' 1 [[CPD-16825]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (S)-equol[c] '''+''' 1 3'-phosphoadenylyl-sulfate[c] '''<=>''' 1 (S)-equol 4'-sulfate[c] '''+''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-06_007320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_003630]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_007300]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_005410]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_007310]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 120-80-9
+
{{#set: direction=REVERSIBLE}}
−
* DRUGBANK : DB02232
+
{{#set: common name=Aryl sulfotransferase}}
−
* PUBCHEM:
+
{{#set: common name=P-loop containing nucleoside triphosphate hydrolase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=289 289]
+
{{#set: common name=Sulfotransferase domain}}
−
* HMDB : HMDB00957
+
{{#set: ec number=EC-2.8.2.1}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-06_007320|Ec-26_003630|Ec-06_007300|Ec-00_005410|Ec-06_007310}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00090 C00090]
+
{{#set: in pathway=}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.13837760.html 13837760]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18135 18135]
+
−
* METABOLIGHTS : MTBLC18135
+
−
{{#set: smiles=C1(C=CC(=C(C=1)O)O)}}
+
−
{{#set: inchi key=InChIKey=YCIMNLLNPGFGHC-UHFFFAOYSA-N}}
+
−
{{#set: common name=catechol}}
+
−
{{#set: molecular weight=110.112    }}
+
−
{{#set: common name=pyrocatechol|2-hydroxyphenol|pyrocatechin|1,2-dihydroxybenzene|1,2-benzenediol}}
+
−
{{#set: produced by=RXN-3661}}
+

Latest revision as of 19:01, 21 March 2018

Reaction RXN-15589

  • direction:
    • REVERSIBLE
  • common name:
    • Aryl sulfotransferase
    • P-loop containing nucleoside triphosphate hydrolase
    • Sulfotransferase domain
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (S)-equol[c] + 1 3'-phosphoadenylyl-sulfate[c] <=> 1 (S)-equol 4'-sulfate[c] + 1 H+[c] + 1 adenosine 3',5'-bisphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15589&oldid=23873"