Difference between revisions of "D-ERYTHRO-IMIDAZOLE-GLYCEROL-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E- E-] == * Synonym(s): == Reaction(s) known to consume the compound == * RXN0-5245 * RX...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ERYTHRO-IMIDAZOLE-GLYCEROL-P D-ERYTHRO-IMIDAZOLE-GLYCEROL-P] == * smiles: ** C1(NC=NC=1C(C(O)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ERYTHRO-IMIDAZOLE-GLYCEROL-P D-ERYTHRO-IMIDAZOLE-GLYCEROL-P] == |
+ | * smiles: | ||
+ | ** C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O) | ||
+ | * inchi key: | ||
+ | ** InChIKey=HFYBTHCYPKEDQQ-RITPCOANSA-L | ||
+ | * common name: | ||
+ | ** D-erythro-imidazole-glycerol-phosphate | ||
+ | * molecular weight: | ||
+ | ** 236.121 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate | ||
+ | ** D-erythro-imidazole-glycerol-P | ||
+ | ** erythro-imidazole-glycerol-P | ||
+ | ** erythro-imidazole-glycerol-phosphate | ||
+ | ** imidazole glycerol phosphate | ||
+ | ** IGP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[IMIDPHOSDEHYD-RXN]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[GLUTAMIDOTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459954 5459954] | ||
+ | * HMDB : HMDB12208 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04666 C04666] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573672.html 4573672] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58278 58278] | ||
+ | * BIGG : 44288 | ||
+ | {{#set: smiles=C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)}} | ||
+ | {{#set: inchi key=InChIKey=HFYBTHCYPKEDQQ-RITPCOANSA-L}} | ||
+ | {{#set: common name=D-erythro-imidazole-glycerol-phosphate}} | ||
+ | {{#set: molecular weight=236.121 }} | ||
+ | {{#set: common name=D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate|D-erythro-imidazole-glycerol-P|erythro-imidazole-glycerol-P|erythro-imidazole-glycerol-phosphate|imidazole glycerol phosphate|IGP}} | ||
+ | {{#set: consumed by=IMIDPHOSDEHYD-RXN}} | ||
+ | {{#set: produced by=GLUTAMIDOTRANS-RXN}} |
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P
- smiles:
- C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)
- inchi key:
- InChIKey=HFYBTHCYPKEDQQ-RITPCOANSA-L
- common name:
- D-erythro-imidazole-glycerol-phosphate
- molecular weight:
- 236.121
- Synonym(s):
- D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate
- D-erythro-imidazole-glycerol-P
- erythro-imidazole-glycerol-P
- erythro-imidazole-glycerol-phosphate
- imidazole glycerol phosphate
- IGP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)" cannot be used as a page name in this wiki.