Difference between revisions of "CU+2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLACETATE PHENYLACETATE] == * smiles: ** C1(=CC=C(C=C1)CC([O-])=O) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CU+2 CU+2] == * smiles: ** [Cu++] * inchi key: ** InChIKey=JPVYNHNXODAKFH-UHFFFAOYSA-N * common...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CU+2 CU+2] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [Cu++] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JPVYNHNXODAKFH-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** Cu2+ |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 63.546 |
* Synonym(s): | * Synonym(s): | ||
| − | ** 2 | + | ** Cu+2 |
| − | ** | + | ** Cu++ |
| − | ** | + | ** cupric ion |
| + | ** cupric copper | ||
| + | ** Cu(II) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[TransportSeed_CU+2]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[TransportSeed_CU+2]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[ExchangeSeed_CU+2]] |
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=27099 27099] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.25221.html 25221] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29036 29036] |
| − | * BIGG : | + | * BIGG : 50600 |
| − | {{#set: smiles= | + | * HMDB : HMDB00657 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=[Cu++]}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=JPVYNHNXODAKFH-UHFFFAOYSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: common name=Cu2+}} |
| − | {{#set: common name=2 | + | {{#set: molecular weight=63.546 }} |
| − | {{#set: reversible reaction associated= | + | {{#set: common name=Cu+2|Cu++|cupric ion|cupric copper|Cu(II)}} |
| + | {{#set: consumed by=TransportSeed_CU+2}} | ||
| + | {{#set: produced by=TransportSeed_CU+2}} | ||
| + | {{#set: reversible reaction associated=ExchangeSeed_CU+2}} | ||
Latest revision as of 19:08, 21 March 2018
Contents
Metabolite CU+2
- smiles:
- [Cu++]
- inchi key:
- InChIKey=JPVYNHNXODAKFH-UHFFFAOYSA-N
- common name:
- Cu2+
- molecular weight:
- 63.546
- Synonym(s):
- Cu+2
- Cu++
- cupric ion
- cupric copper
- Cu(II)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
