Difference between revisions of "CREATINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * smiles: ** C(C(=O)[O-])N(C)C(N)=[N+] * inchi key: ** InChIKey=CVSVTCORW...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14715 RXN-14715] == * direction: ** LEFT-TO-RIGHT * common name: ** 2-trans,4-trans-tetradecadi...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14715 RXN-14715] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-trans,4-trans-tetradecadienoyl-CoA reductase |
− | * | + | ** NAD(P)-binding domain |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.3.1.34 EC-1.3.1.34] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[NADPH]][c] '''+''' 1 [[CPD-15566]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-15567]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 NADPH[c] '''+''' 1 2-trans,4-trans-tetradecadienoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 3-trans-tetradecenoyl-CoA[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Ec-16_003950]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7307]], oleate β-oxidation (reductase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7307 PWY-7307] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=2-trans,4-trans-tetradecadienoyl-CoA reductase}} | |
− | + | {{#set: common name=NAD(P)-binding domain}} | |
− | + | {{#set: ec number=EC-1.3.1.34}} | |
− | + | {{#set: gene associated=Ec-16_003950}} | |
− | + | {{#set: in pathway=PWY-7307}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:50, 17 March 2018
Contents
Reaction RXN-14715
- direction:
- LEFT-TO-RIGHT
- common name:
- 2-trans,4-trans-tetradecadienoyl-CoA reductase
- NAD(P)-binding domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADPH[c] + 1 2-trans,4-trans-tetradecadienoyl-CoA[c] + 1 H+[c] => 1 NADP+[c] + 1 3-trans-tetradecenoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-16_003950
- ESILICULOSUS_GENOME
- EC-NUMBER
- ESILICULOSUS_GENOME
Pathways
- PWY-7307, oleate β-oxidation (reductase-dependent, yeast): PWY-7307
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome