Difference between revisions of "CREATINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * smiles: ** C(C(=O)[O-])N(C)C(N)=[N+] * inchi key: ** InChIKey=CVSVTCORW...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14715 RXN-14715] == * direction: ** LEFT-TO-RIGHT * common name: ** 2-trans,4-trans-tetradecadi...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14715 RXN-14715] ==
−
* smiles:
+
* direction:
−
** C(C(=O)[O-])N(C)C(N)=[N+]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CVSVTCORWBXHQV-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** creatine
+
** 2-trans,4-trans-tetradecadienoyl-CoA reductase
−
* molecular weight:
+
** NAD(P)-binding domain
−
** 131.134   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.34 EC-1.3.1.34]
 
* Synonym(s):
 
* Synonym(s):
−
** methylguanidinoacetic acid
 
−
** N-amidinosarcosine
 
−
** methylglycocyamine
 
−
** N-methyl-N-guanylglycine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[CREATINASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[CPD-15566]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-15567]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[CREATINE-KINASE-RXN]]
+
** 1 NADPH[c] '''+''' 1 2-trans,4-trans-tetradecadienoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 NADP+[c] '''+''' 1 3-trans-tetradecenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-16_003950]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7307]], oleate β-oxidation (reductase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7307 PWY-7307]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 57-00-1
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=2-trans,4-trans-tetradecadienoyl-CoA reductase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058172 7058172]
+
{{#set: common name=NAD(P)-binding domain}}
−
* HMDB : HMDB00064
+
{{#set: ec number=EC-1.3.1.34}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-16_003950}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00300 C00300]
+
{{#set: in pathway=PWY-7307}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.5414502.html 5414502]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57947 57947]
+
−
* METABOLIGHTS : MTBLC57947
+
−
{{#set: smiles=C(C(=O)[O-])N(C)C(N)=[N+]}}
+
−
{{#set: inchi key=InChIKey=CVSVTCORWBXHQV-UHFFFAOYSA-N}}
+
−
{{#set: common name=creatine}}
+
−
{{#set: molecular weight=131.134    }}
+
−
{{#set: common name=methylguanidinoacetic acid|N-amidinosarcosine|methylglycocyamine|N-methyl-N-guanylglycine}}
+
−
{{#set: consumed by=CREATINASE-RXN}}
+
−
{{#set: consumed or produced by=CREATINE-KINASE-RXN}}
+

Revision as of 20:50, 17 March 2018

Reaction RXN-14715

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 2-trans,4-trans-tetradecadienoyl-CoA reductase
    • NAD(P)-binding domain
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NADPH[c] + 1 2-trans,4-trans-tetradecadienoyl-CoA[c] + 1 H+[c] => 1 NADP+[c] + 1 3-trans-tetradecenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7307, oleate β-oxidation (reductase-dependent, yeast): PWY-7307
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CREATINE&oldid=10559"