Difference between revisions of "CPD-13377"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_003040 == * left end position: ** 2891683 * transcription direction: ** POSITIVE * right end position: ** 2894665 * centisome position: ** 43.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == |
| − | * | + | * smiles: |
| − | ** | + | ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N |
| − | * | + | * common name: |
| − | ** | + | ** XLXG xyloglucan oligosaccharide |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1225.073 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-12399]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940192 52940192] | |
| − | {{#set: | + | {{#set: smiles=C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=XLXG xyloglucan oligosaccharide}} |
| − | {{#set: | + | {{#set: molecular weight=1225.073 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-12399}} |
Latest revision as of 19:45, 21 March 2018
Contents
Metabolite CPD-13377
- smiles:
- C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
- inchi key:
- InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
- common name:
- XLXG xyloglucan oligosaccharide
- molecular weight:
- 1225.073
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
