Difference between revisions of "PWY-6317"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE-KIN-RXN PANTOTHENATE-KIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** panto...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(=O)C([O-])=O)C(C([O-])=O)O |
+ | * inchi key: | ||
+ | ** InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** (4S)-4-hydroxy-2-oxoglutarate |
− | * | + | * molecular weight: |
− | ** | + | ** 160.083 |
* Synonym(s): | * Synonym(s): | ||
+ | ** L-4-hydroxy-2-oxoglutarate | ||
+ | ** L-4-hydroxy-2-ketoglutarate | ||
+ | ** (S)-2-hydroxy-4-oxopentanedioate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-13990]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698337 70698337] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685] |
− | + | * METABOLIGHTS : MTBLC71685 | |
− | + | {{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}} | |
− | + | {{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L}} | |
− | * | + | {{#set: common name=(4S)-4-hydroxy-2-oxoglutarate}} |
− | {{#set: | + | {{#set: molecular weight=160.083 }} |
− | {{#set: | + | {{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}} |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-13990}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 21:16, 17 March 2018
Contents
Metabolite CPD-15016
- smiles:
- C(C(=O)C([O-])=O)C(C([O-])=O)O
- inchi key:
- InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
- common name:
- (4S)-4-hydroxy-2-oxoglutarate
- molecular weight:
- 160.083
- Synonym(s):
- L-4-hydroxy-2-oxoglutarate
- L-4-hydroxy-2-ketoglutarate
- (S)-2-hydroxy-4-oxopentanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(=O)C([O-])=O)C(C([O-])=O)O" cannot be used as a page name in this wiki.