Difference between revisions of "Ec-22 000080"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] == * smiles: ** C(C(=O)C([O-])=O)C(C([O-])=O)O * inchi key: ** InChIKey=WX...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5856 PWY-5856] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15016 CPD-15016] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5856 PWY-5856] ==
−
* smiles:
+
* taxonomic range:
−
** C(C(=O)C([O-])=O)C(C([O-])=O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L
+
 
* common name:
 
* common name:
−
** (4S)-4-hydroxy-2-oxoglutarate
+
** ubiquinol-9 biosynthesis (prokaryotic)
−
* molecular weight:
+
−
** 160.083   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-4-hydroxy-2-oxoglutarate
+
** Q9 biosynthesis
−
** L-4-hydroxy-2-ketoglutarate
+
** ubiquinone-9 biosynthesis (prokaryotic)
−
** (S)-2-hydroxy-4-oxopentanedioate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''8''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[2.5.1.39-RXN]]
−
* [[RXN-13990]]
+
** 1 associated gene(s):
 +
*** [[Ec-00_007360]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.64-RXN 2.1.1.64-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9238 RXN-9238]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9239 RXN-9239]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9240 RXN-9240]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9241 RXN-9241]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9242 RXN-9242]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9243 RXN-9243]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70698337 70698337]
+
{{#set: common name=ubiquinol-9 biosynthesis (prokaryotic)}}
−
* CHEBI:
+
{{#set: common name=Q9 biosynthesis|ubiquinone-9 biosynthesis (prokaryotic)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71685 71685]
+
{{#set: reaction found=1}}
−
* METABOLIGHTS : MTBLC71685
+
{{#set: total reaction=8}}
−
{{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}}
+
{{#set: completion rate=13.0}}
−
{{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-REOHCLBHSA-L}}
+
−
{{#set: common name=(4S)-4-hydroxy-2-oxoglutarate}}
+
−
{{#set: molecular weight=160.083    }}
+
−
{{#set: common name=L-4-hydroxy-2-oxoglutarate|L-4-hydroxy-2-ketoglutarate|(S)-2-hydroxy-4-oxopentanedioate}}
+
−
{{#set: consumed or produced by=RXN-13990}}
+

Revision as of 21:17, 17 March 2018

Pathway PWY-5856

  • taxonomic range:
  • common name:
    • ubiquinol-9 biosynthesis (prokaryotic)
  • Synonym(s):
    • Q9 biosynthesis
    • ubiquinone-9 biosynthesis (prokaryotic)

Reaction(s) found

1 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-22_000080&oldid=12370"