Difference between revisions of "PWY-4101"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InChIKey=VOKUMXABRRXHA...")
 
(Created page with "Category:Gene == Gene Ec-04_001210 == * left end position: ** 1359364 * transcription direction: ** POSITIVE * right end position: ** 1364832 * centisome position: ** 20.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
+
== Gene Ec-04_001210 ==
−
* smiles:
+
* left end position:
−
** CC([CH]=O)C(=O)[O-]
+
** 1359364
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (R)-methylmalonate-semialdehyde
+
** 1364832
−
* molecular weight:
+
* centisome position:
−
** 101.082    
+
** 20.875233    
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-2-methyl-3-oxopropanoate
+
** Esi_0101_0025
−
** (R)-ch3-malonate-semialdehyde
+
** Esi0101_0025
 +
** DOLPP1
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[DOLICHYLDIPHOSPHATASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
−
* [[RXN-14056]]
+
***ec-number
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1359364}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
+
{{#set: right end position=1364832}}
−
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
+
{{#set: centisome position=20.875233   }}
−
{{#set: common name=(R)-methylmalonate-semialdehyde}}
+
{{#set: common name=Esi_0101_0025|Esi0101_0025|DOLPP1}}
−
{{#set: molecular weight=101.082   }}
+
{{#set: reaction associated=DOLICHYLDIPHOSPHATASE-RXN}}
−
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
+
−
{{#set: consumed or produced by=RXN-14056}}
+

Revision as of 20:28, 17 March 2018

Gene Ec-04_001210

  • left end position:
    • 1359364
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1364832
  • centisome position:
    • 20.875233
  • Synonym(s):
    • Esi_0101_0025
    • Esi0101_0025
    • DOLPP1

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-4101&oldid=9034"