Difference between revisions of "SACCHAROPINE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_000870 == * Synonym(s): ** Esi_0029_0138 ** Esi0029_0138 == Reactions associated == * RXN-4726 ** pantograph-aragem * RXN-4733...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == |
| + | * smiles: | ||
| + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K | ||
| + | * common name: | ||
| + | ** ADP ribose 1'',2''-cyclic phosphate | ||
| + | * molecular weight: | ||
| + | ** 618.26 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ADP ribose 1''-2''-cyclic phosphate |
| − | ** | + | ** ADP ribose 1'',2''-phosphate |
| + | ** adenosine diphosphate ribose 1'',2''-cyclic phosphate | ||
| + | ** Appr>p | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | * [[RXN-12055]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[ | + | * [[2.7.1.160-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245989 25245989] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76596 76596] | ||
| + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K}} | ||
| + | {{#set: common name=ADP ribose 1'',2''-cyclic phosphate}} | ||
| + | {{#set: molecular weight=618.26 }} | ||
| + | {{#set: common name=ADP ribose 1''-2''-cyclic phosphate|ADP ribose 1'',2''-phosphate|adenosine diphosphate ribose 1'',2''-cyclic phosphate|Appr>p}} | ||
| + | {{#set: consumed by=RXN-12055}} | ||
| + | {{#set: produced by=2.7.1.160-RXN}} | ||
Revision as of 21:56, 17 March 2018
Contents
Metabolite CPD-9007
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O
- inchi key:
- InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
- common name:
- ADP ribose 1,2-cyclic phosphate
- molecular weight:
- 618.26
- Synonym(s):
- ADP ribose 1-2-cyclic phosphate
- ADP ribose 1,2-phosphate
- adenosine diphosphate ribose 1,2-cyclic phosphate
- Appr>p
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O" cannot be used as a page name in this wiki.
"Appr>p" cannot be used as a page name in this wiki.
