Difference between revisions of "Ec-00 002040"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...")
 
(Created page with "Category:Gene == Gene Ec-23_003230 == * left end position: ** 3498039 * transcription direction: ** POSITIVE * right end position: ** 3502228 * centisome position: ** 72.2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
+
== Gene Ec-23_003230 ==
−
* smiles:
+
* left end position:
−
** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
+
** 3498039
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** prephytoene diphosphate
+
** 3502228
−
* molecular weight:
+
* centisome position:
−
** 719.897    
+
** 72.281494    
 
* Synonym(s):
 
* Synonym(s):
−
** (1R,2R,3R)-prephytoene diphosphate
+
** Esi_0128_0056
 +
** Esi0128_0056
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXNARA-8002]]
+
* [[2.4.1.223-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[2.5.1.32-RXN]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-6558]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3498039}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245670 25245670]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3502228}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011]
+
{{#set: centisome position=72.281494   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0128_0056|Esi0128_0056}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427]
+
{{#set: reaction associated=2.4.1.223-RXN}}
−
* HMDB : HMDB03023
+
{{#set: pathway associated=PWY-6558}}
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-XGYYIUAYSA-K}}
+
−
{{#set: common name=prephytoene diphosphate}}
+
−
{{#set: molecular weight=719.897   }}
+
−
{{#set: common name=(1R,2R,3R)-prephytoene diphosphate}}
+
−
{{#set: consumed by=RXNARA-8002}}
+
−
{{#set: produced by=2.5.1.32-RXN}}
+

Revision as of 22:05, 17 March 2018

Gene Ec-23_003230

  • left end position:
    • 3498039
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3502228
  • centisome position:
    • 72.281494
  • Synonym(s):
    • Esi_0128_0056
    • Esi0128_0056

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_002040&oldid=15724"