Difference between revisions of "Mitochondrial-Preproteins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-formyl-L-methionyl-tRNAfmet N-formyl-L-methionyl-tRNAfmet] == * common name: ** an N-formyl-L...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBALT-SIROHYDROCHLORIN COBALT-SIROHYDROCHLORIN] == * smiles: ** CC1(CC(=O)[O-])(C2(=CC5(C(CCC(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBALT-SIROHYDROCHLORIN COBALT-SIROHYDROCHLORIN] == |
| + | * smiles: | ||
| + | ** CC1(CC(=O)[O-])(C2(=CC5(C(CCC(=O)[O-])C(C)(CC(=O)[O-])C6(=CC4(=C(CC(=O)[O-])C(CCC(=O)[O-])=C3(C=C8(C(CCC(=O)[O-])=C(CC(=O)[O-])C7(C=C(C(CCC(=O)[O-])1)N2[Co--](N34)([N+]=56)[N+]=78)))))))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=XZMXJYDTAININL-QIISWYHFSA-D | ||
* common name: | * common name: | ||
| − | ** | + | ** cobalt-sirohydrochlorin |
| + | * molecular weight: | ||
| + | ** 911.694 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** cobalt-factor II | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4.99.1.3-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678581 70678581] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60049 60049] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11538 C11538] | ||
| + | {{#set: smiles=CC1(CC(=O)[O-])(C2(=CC5(C(CCC(=O)[O-])C(C)(CC(=O)[O-])C6(=CC4(=C(CC(=O)[O-])C(CCC(=O)[O-])=C3(C=C8(C(CCC(=O)[O-])=C(CC(=O)[O-])C7(C=C(C(CCC(=O)[O-])1)N2[Co--](N34)([N+]=56)[N+]=78))))))))}} | ||
| + | {{#set: inchi key=InChIKey=XZMXJYDTAININL-QIISWYHFSA-D}} | ||
| + | {{#set: common name=cobalt-sirohydrochlorin}} | ||
| + | {{#set: molecular weight=911.694 }} | ||
| + | {{#set: common name=cobalt-factor II}} | ||
| + | {{#set: produced by=4.99.1.3-RXN}} | ||
Revision as of 22:06, 17 March 2018
Contents
Metabolite COBALT-SIROHYDROCHLORIN
- smiles:
- CC1(CC(=O)[O-])(C2(=CC5(C(CCC(=O)[O-])C(C)(CC(=O)[O-])C6(=CC4(=C(CC(=O)[O-])C(CCC(=O)[O-])=C3(C=C8(C(CCC(=O)[O-])=C(CC(=O)[O-])C7(C=C(C(CCC(=O)[O-])1)N2[Co--](N34)([N+]=56)[N+]=78))))))))
- inchi key:
- InChIKey=XZMXJYDTAININL-QIISWYHFSA-D
- common name:
- cobalt-sirohydrochlorin
- molecular weight:
- 911.694
- Synonym(s):
- cobalt-factor II
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(CC(=O)[O-])(C2(=CC5(C(CCC(=O)[O-])C(C)(CC(=O)[O-])C6(=CC4(=C(CC(=O)[O-])C(CCC(=O)[O-])=C3(C=C8(C(CCC(=O)[O-])=C(CC(=O)[O-])C7(C=C(C(CCC(=O)[O-])1)N2[Co--](N34)([N+]=56)[N+]=78))))))))" cannot be used as a page name in this wiki.
