Difference between revisions of "L-LACTATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-157 RXN1G-157] == * direction: ** REVERSIBLE * common name: ** 3-oxo-behenoyl-[acyl-carrier p...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C)) |
+ | * inchi key: | ||
+ | ** InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** γ-tocopherol |
− | * | + | * molecular weight: |
− | + | ** 416.686 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 7,8-dimethyltocol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-2543]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92729 92729] | |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.83708.html 83708] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18185 18185] |
− | {{#set: | + | * METABOLIGHTS : MTBLC18185 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02483 C02483] |
+ | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C))}} | ||
+ | {{#set: inchi key=InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N}} | ||
+ | {{#set: common name=γ-tocopherol}} | ||
+ | {{#set: molecular weight=416.686 }} | ||
+ | {{#set: common name=7,8-dimethyltocol}} | ||
+ | {{#set: consumed by=TOCOPHEROL-O-METHYLTRANSFERASE-RXN}} | ||
+ | {{#set: produced by=RXN-2543}} |
Revision as of 13:11, 21 March 2018
Contents
Metabolite GAMA-TOCOPHEROL
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C))
- inchi key:
- InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N
- common name:
- γ-tocopherol
- molecular weight:
- 416.686
- Synonym(s):
- 7,8-dimethyltocol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links