Difference between revisions of "RXN-10949"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] == * smiles: ** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(...")
 
(Created page with "Category:Gene == Gene Ec-24_003520 == * left end position: ** 3837228 * transcription direction: ** POSITIVE * right end position: ** 3839956 * centisome position: ** 76.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] ==
+
== Gene Ec-24_003520 ==
−
* smiles:
+
* left end position:
−
** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))
+
** 3837228
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** MoO2-molybdopterin cofactor
+
** 3839956
−
* molecular weight:
+
* centisome position:
−
** 519.251    
+
** 76.93425    
 
* Synonym(s):
 
* Synonym(s):
−
** MoCo (dioxyo)
+
** Esi_0034_0074
−
** molybdenum cofactor (dioxyo)
+
** Esi0034_0074
−
** MoO2(OH)Dtpp-mP
+
** SATase
−
** {[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate
+
−
** MoO2-Mo-MPT
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[SERINE-O-ACETTRAN-RXN]]
−
* [[RXN-8348]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 +
* [[CYSTSYN-PWY]]
 +
* [[PWY-7274]]
 +
* [[PWY-6936]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3837228}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70680283 70680283]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3839956}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71302 71302]
+
{{#set: centisome position=76.93425   }}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))}}
+
{{#set: common name=Esi_0034_0074|Esi0034_0074|SATase}}
−
{{#set: inchi key=InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J}}
+
{{#set: reaction associated=SERINE-O-ACETTRAN-RXN}}
−
{{#set: common name=MoO2-molybdopterin cofactor}}
+
{{#set: pathway associated=CYSTSYN-PWY|PWY-7274|PWY-6936}}
−
{{#set: molecular weight=519.251   }}
+
−
{{#set: common name=MoCo (dioxyo)|molybdenum cofactor (dioxyo)|MoO2(OH)Dtpp-mP|{[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate|MoO2-Mo-MPT}}
+
−
{{#set: produced by=RXN-8348}}
+

Revision as of 20:42, 17 March 2018

Gene Ec-24_003520

  • left end position:
    • 3837228
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3839956
  • centisome position:
    • 76.93425
  • Synonym(s):
    • Esi_0034_0074
    • Esi0034_0074
    • SATase

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10949&oldid=10029"