Difference between revisions of "PWY-6999"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == * smiles: ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16067 RXN-16067] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acyl-sn-glycerol-3-phosph...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16067 RXN-16067] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
+
** 1-acyl-sn-glycerol-3-phosphate acyltransferase
* molecular weight:
+
* ec number:
** 987.845   
+
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
 
** (S)-3-hydroxy-14:1-Δ5-CoA
 
** (3S)-hydroxy-5-cis-tetradecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN0-5393]]
+
** 1 [[Long-Chain-Acyl-ACPs]][c] '''+''' 1 [[CPD0-2113]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[1-Stearoyl-L-Phosphatidate]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a long-chain acyl-[acyl-carrier protein][c] '''+''' 1 1-stearoyl-sn-glycerol 3-phosphate[c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 a 1-stearoyl 2-acyl-sn-glycerol 3-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-21_003240]]
 +
** ESILICULOSUS_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
* [[Ec-12_004670]]
 +
** ESILICULOSUS_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
* [[Ec-02_006160]]
 +
** ESILICULOSUS_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
* [[Ec-26_001280]]
 +
** ESILICULOSUS_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7587]], oleate biosynthesis III (cyanobacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7587 PWY-7587]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244729 25244729]
+
{{#set: common name=1-acyl-sn-glycerol-3-phosphate acyltransferase}}
{{#set: smiles=CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: ec number=EC-2.3.1.51}}
{{#set: inchi key=InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J}}
+
{{#set: gene associated=Ec-21_003240|Ec-12_004670|Ec-02_006160|Ec-26_001280}}
{{#set: common name=(S)-3-hydroxy-(5Z)-tetradecenoyl-CoA}}
+
{{#set: in pathway=PWY-7587}}
{{#set: molecular weight=987.845    }}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=(S)-3-hydroxy-5-cis-tetradecenoyl-CoA|(S)-3-hydroxy-14:1-Δ5-CoA|(3S)-hydroxy-5-cis-tetradecenoyl-CoA}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: produced by=RXN0-5393}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 21:51, 17 March 2018

Reaction RXN-16067

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 1-acyl-sn-glycerol-3-phosphate acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a long-chain acyl-[acyl-carrier protein][c] + 1 1-stearoyl-sn-glycerol 3-phosphate[c] => 1 a holo-[acyl-carrier protein][c] + 1 a 1-stearoyl 2-acyl-sn-glycerol 3-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7587, oleate biosynthesis III (cyanobacteria): PWY-7587
    • 2 reactions found over 3 reactions in the full pathway

Reconstruction information

External links