Difference between revisions of "PWY-7724"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
 
(Created page with "Category:Gene == Gene Ec-23_003460 == * left end position: ** 3706742 * transcription direction: ** POSITIVE * right end position: ** 3715455 * centisome position: ** 76.5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
+
== Gene Ec-23_003460 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 3706742
−
* inchi key:
+
* transcription direction:
−
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 24-methylenecholesterol
+
** 3715455
−
* molecular weight:
+
* centisome position:
−
** 398.671    
+
** 76.59401    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0128_0027
 +
** Esi0128_0027
 +
** FUMH
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[FUMHYDR-RXN]]
−
* [[RXN-707]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 +
* [[PWY-561]]
 +
* [[PWY-5913]]
 +
* [[P42-PWY]]
 +
* [[PWY-7384]]
 +
* [[PWY-5392]]
 +
* [[P23-PWY]]
 +
* [[P105-PWY]]
 +
* [[PWY-6969]]
 +
* [[FERMENTATION-PWY]]
 +
* [[PWY-6728]]
 +
* [[REDCITCYC]]
 +
* [[PWY-7254]]
 +
* [[P108-PWY]]
 +
* [[PWY-5690]]
 +
* [[PWY66-398]]
 +
* [[TCA]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3706742}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724573 23724573]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: right end position=3715455}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
+
{{#set: centisome position=76.59401    }}
−
* HMDB : HMDB06849
+
{{#set: common name=Esi_0128_0027|Esi0128_0027|FUMH}}
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reaction associated=FUMHYDR-RXN}}
−
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
+
{{#set: pathway associated=PWY-561|PWY-5913|P42-PWY|PWY-7384|PWY-5392|P23-PWY|P105-PWY|PWY-6969|FERMENTATION-PWY|PWY-6728|REDCITCYC|PWY-7254|P108-PWY|PWY-5690|PWY66-398|TCA}}
−
{{#set: common name=24-methylenecholesterol}}
+
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: produced by=RXN-707}}
+

Revision as of 20:54, 17 March 2018

Gene Ec-23_003460

  • left end position:
    • 3706742
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3715455
  • centisome position:
    • 76.59401
  • Synonym(s):
    • Esi_0128_0027
    • Esi0128_0027
    • FUMH

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7724&oldid=10820"