Difference between revisions of "PWY-7318"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...")
 
(Created page with "Category:Gene == Gene Ec-17_001590 == * left end position: ** 1677514 * transcription direction: ** POSITIVE * right end position: ** 1682647 * centisome position: ** 34.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
+
== Gene Ec-17_001590 ==
−
* smiles:
+
* left end position:
−
** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
+
** 1677514
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** dihydrogeranylgeranyl diphosphate
+
** 1682647
−
* molecular weight:
+
* centisome position:
−
** 449.44    
+
** 34.963165    
 
* Synonym(s):
 
* Synonym(s):
−
** dihydroGGPP
+
** Esi_0149_0059
−
** dihydrogeranylgeranyl-PP
+
** Esi0149_0059
−
** dihydrogeranylgeranyl pyrophosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7659]]
+
* [[RXN0-5217]]
−
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[aragem]]
−
* [[RXN-7658]]
+
* [[SPERMIDINESYN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** esiliculosus_genome
 +
***go-term
 +
** [[pantograph]]-[[aragem]]
 +
* [[SPERMINE-SYNTHASE-RXN]]
 +
** esiliculosus_genome
 +
***go-term
 +
== Pathways associated ==
 +
* [[ARGSPECAT-PWY]]
 +
* [[POLYAMINSYN3-PWY]]
 +
* [[BSUBPOLYAMSYN-PWY]]
 +
* [[PWY0-1303]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1677514}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
+
{{#set: right end position=1682647}}
−
{{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}}
+
{{#set: centisome position=34.963165   }}
−
{{#set: common name=dihydrogeranylgeranyl diphosphate}}
+
{{#set: common name=Esi_0149_0059|Esi0149_0059}}
−
{{#set: molecular weight=449.44   }}
+
{{#set: reaction associated=RXN0-5217|SPERMIDINESYN-RXN|SPERMINE-SYNTHASE-RXN}}
−
{{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}}
+
{{#set: pathway associated=ARGSPECAT-PWY|POLYAMINSYN3-PWY|BSUBPOLYAMSYN-PWY|PWY0-1303}}
−
{{#set: consumed by=RXN-7659}}
+
−
{{#set: produced by=RXN-7658}}
+

Revision as of 21:15, 17 March 2018

Gene Ec-17_001590

  • left end position:
    • 1677514
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1682647
  • centisome position:
    • 34.963165
  • Synonym(s):
    • Esi_0149_0059
    • Esi0149_0059

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7318&oldid=12300"