Difference between revisions of "RXN-8630"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Ec-23_003770 == * left end position: ** 4103064 * transcription direction: ** POSITIVE * right end position: ** 4117414 * centisome position: ** 84.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_003770 == |
− | * | + | * left end position: |
− | ** | + | ** 4103064 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4117414 |
− | * | + | * centisome position: |
− | ** | + | ** 84.78339 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0118_0049 |
+ | ** Esi0118_0049 | ||
− | == | + | == Reactions associated == |
− | + | * [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***go-term |
+ | * [[RXN-17203]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4103064}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4117414}} | |
− | + | {{#set: centisome position=84.78339 }} | |
− | + | {{#set: common name=Esi_0118_0049|Esi0118_0049}} | |
− | {{#set: | + | {{#set: reaction associated=GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN|RXN-17203}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:21, 17 March 2018
Gene Ec-23_003770
- left end position:
- 4103064
- transcription direction:
- POSITIVE
- right end position:
- 4117414
- centisome position:
- 84.78339
- Synonym(s):
- Esi_0118_0049
- Esi0118_0049
Reactions associated
- GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-17203
- esiliculosus_genome
- go-term
- esiliculosus_genome