Difference between revisions of "RXN0-6359"

Revision as of 22:29, 17 March 2018

"C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxydodecanoyl-ACPs R-3-hydroxydodecanoyl-ACPs] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] ==
+* smiles:
+** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))
+* inchi key:
+** InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O
 * common name:
-** a (3R)-3-hydroxydodecanoyl-[acp]
+** 2'-hydroxynicotine
+* molecular weight:
+** 179.241
 * Synonym(s):
-** a &beta;-hydroxydodecanoyl-[acp]
 == Reaction(s) known to consume the compound ==
-* [[RXN-9533]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-9532]]
+* [[RXN66-146]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=a (3R)-3-hydroxydodecanoyl-[acp]}}
+* PUBCHEM:
-{{#set: common name=a &beta;-hydroxydodecanoyl-[acp]}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245599 25245599]
-{{#set: consumed by=RXN-9533}}
+* HMDB : HMDB01329
-{{#set: produced by=RXN-9532}}
+{{#set: smiles=C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))}}
+{{#set: inchi key=InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O}}
+{{#set: common name=2'-hydroxynicotine}}
+{{#set: molecular weight=179.241    }}
+{{#set: produced by=RXN66-146}}