Difference between revisions of "DTDP-D-GLUCOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == * smiles: ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MBCOA-DHLIPOAMIDE-RXN MBCOA-DHLIPOAMIDE-RXN] == * direction: ** REVERSIBLE * common name: ** dihydr...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MBCOA-DHLIPOAMIDE-RXN MBCOA-DHLIPOAMIDE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 2- | + | ** dihydrolipoyllysine-residue (2-methylbutanoyl)transferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.168 EC-2.3.1.168] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[BCAA-dehydrogenase-DH-lipoyl]][c] '''+''' 1 [[2-METHYL-BUTYRYL-COA]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[BCAA-dehydrogenase-2MB-DH-lipoyl]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 an [apo BCAA dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine[c] '''+''' 1 2-methylbutanoyl-CoA[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 an [apo BCAA dehydrogenase E2 protein] N6-S-[2-methylbutanoyl]dihydrolipoyl-L-lysine[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=dihydrolipoyllysine-residue (2-methylbutanoyl)transferase}} | |
− | + | {{#set: ec number=EC-2.3.1.168}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:33, 17 March 2018
Contents
Reaction MBCOA-DHLIPOAMIDE-RXN
- direction:
- REVERSIBLE
- common name:
- dihydrolipoyllysine-residue (2-methylbutanoyl)transferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 BCAA-dehydrogenase-DH-lipoyl[c] + 1 2-METHYL-BUTYRYL-COA[c] <=> 1 CO-A[c] + 1 BCAA-dehydrogenase-2MB-DH-lipoyl[c]
- With common name(s):
- 1 an [apo BCAA dehydrogenase E2 protein] N6-dihydrolipoyl-L-lysine[c] + 1 2-methylbutanoyl-CoA[c] <=> 1 coenzyme A[c] + 1 an [apo BCAA dehydrogenase E2 protein] N6-S-[2-methylbutanoyl]dihydrolipoyl-L-lysine[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome