Difference between revisions of "CPD-17328"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Double-Stranded-DNAs Double-Stranded-DNAs] == * common name: ** a double stranded DNA * Synonym...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SACCHAROPINE SACCHAROPINE] == * smiles: ** C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SACCHAROPINE SACCHAROPINE] == |
+ | * smiles: | ||
+ | ** C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZDGJAHTZVHVLOT-YUMQZZPRSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** L-saccharopine |
+ | * molecular weight: | ||
+ | ** 275.281 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** saccharopine | ||
+ | ** N6-(L-1,3-dicarboxypropyl)-L-lysine | ||
+ | ** ε-N-(L-glutar-2-yl)-L-lysine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[1.5.1.9-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[1.5.1.8-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: consumed | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00449 C00449] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57951 57951] | ||
+ | * METABOLIGHTS : MTBLC57951 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791954 49791954] | ||
+ | * HMDB : HMDB00279 | ||
+ | {{#set: smiles=C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=ZDGJAHTZVHVLOT-YUMQZZPRSA-M}} | ||
+ | {{#set: common name=L-saccharopine}} | ||
+ | {{#set: molecular weight=275.281 }} | ||
+ | {{#set: common name=saccharopine|N6-(L-1,3-dicarboxypropyl)-L-lysine|ε-N-(L-glutar-2-yl)-L-lysine}} | ||
+ | {{#set: consumed by=1.5.1.9-RXN}} | ||
+ | {{#set: produced by=1.5.1.8-RXN}} |
Revision as of 21:56, 17 March 2018
Contents
Metabolite SACCHAROPINE
- smiles:
- C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O
- inchi key:
- InChIKey=ZDGJAHTZVHVLOT-YUMQZZPRSA-M
- common name:
- L-saccharopine
- molecular weight:
- 275.281
- Synonym(s):
- saccharopine
- N6-(L-1,3-dicarboxypropyl)-L-lysine
- ε-N-(L-glutar-2-yl)-L-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O" cannot be used as a page name in this wiki.