Difference between revisions of "Ec-00 003460"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19171 CPD-19171] == * smiles: ** CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(Created page with "Category:Gene == Gene Ec-22_003870 == * left end position: ** 4341648 * transcription direction: ** POSITIVE * right end position: ** 4378281 * centisome position: ** 96.1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19171 CPD-19171] ==
+
== Gene Ec-22_003870 ==
−
* smiles:
+
* left end position:
−
** CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4341648
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LHAYYTCFPMUQNR-DFXYPYGHSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxy-(9Z)-octadecenoyl-CoA
+
** 4378281
−
* molecular weight:
+
* centisome position:
−
** 1043.952    
+
** 96.14241    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-18:1-Δ9-CoA
+
** Esi_0039_0031
−
** (S)-3-hydroxy-9-cis-octadecenoyl-CoA
+
** Esi0039_0031
 +
** DCL1
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17777]]
+
* [[3.1.26.3-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-17776]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=4341648}}
−
{{#set: inchi key=InChIKey=LHAYYTCFPMUQNR-DFXYPYGHSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(S)-3-hydroxy-(9Z)-octadecenoyl-CoA}}
+
{{#set: right end position=4378281}}
−
{{#set: molecular weight=1043.952   }}
+
{{#set: centisome position=96.14241   }}
−
{{#set: common name=(S)-3-hydroxy-18:1-Δ9-CoA|(S)-3-hydroxy-9-cis-octadecenoyl-CoA}}
+
{{#set: common name=Esi_0039_0031|Esi0039_0031|DCL1}}
−
{{#set: consumed by=RXN-17777}}
+
{{#set: reaction associated=3.1.26.3-RXN}}
−
{{#set: produced by=RXN-17776}}
+

Revision as of 22:00, 17 March 2018

Gene Ec-22_003870

  • left end position:
    • 4341648
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4378281
  • centisome position:
    • 96.14241
  • Synonym(s):
    • Esi_0039_0031
    • Esi0039_0031
    • DCL1

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_003460&oldid=15392"