Difference between revisions of "Ec-07 001830"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta7-3-hydroxycerotoyl-ACPs cis-delta7-3-hydroxycerotoyl-ACPs] == * common name: ** a cis...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] == |
| + | * smiles: | ||
| + | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 4α-methyl-5α-ergosta-8,24-dien-3β-ol |
| + | * molecular weight: | ||
| + | ** 412.698 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol | ||
| + | ** 4α-methyl-5α-ergosta-8,24-dien-3β-ol | ||
| + | ** 4α-methylfecosterol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-4144]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=193524 193524] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80094 80094] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15776 C15776] | ||
| + | * HMDB : HMDB06845 | ||
| + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N}} | ||
| + | {{#set: common name=4α-methyl-5α-ergosta-8,24-dien-3β-ol}} | ||
| + | {{#set: molecular weight=412.698 }} | ||
| + | {{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol|4α-methyl-5α-ergosta-8,24-dien-3β-ol|4α-methylfecosterol}} | ||
| + | {{#set: produced by=RXN-4144}} | ||
Revision as of 22:04, 17 March 2018
Contents
Metabolite CPD-4081
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N
- common name:
- 4α-methyl-5α-ergosta-8,24-dien-3β-ol
- molecular weight:
- 412.698
- Synonym(s):
- 4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol
- 4α-methyl-5α-ergosta-8,24-dien-3β-ol
- 4α-methylfecosterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
