Difference between revisions of "Ec-22 000250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-trans-4-cis-dienoyl-CoAs 2-trans-4-cis-dienoyl-CoAs] == * common name: ** a 2-trans-4-cis-die...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * inchi key: ** InChIKey=HMFHBZSHGG...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-trans-4-cis-dienoyl-CoAs 2-trans-4-cis-dienoyl-CoAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] ==
 +
* smiles:
 +
** C(C1(C(C(C(O1)O)O)O))O
 +
* inchi key:
 +
** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
 
* common name:
 
* common name:
** a 2-trans-4-cis-dienoyl-CoA
+
** α-D-ribofuranose
 +
* molecular weight:
 +
** 150.131   
 
* Synonym(s):
 
* Synonym(s):
 +
** α D-ribose
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7835]]
+
* [[RIBOKIN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-14904]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a 2-trans-4-cis-dienoyl-CoA}}
+
* PUBCHEM:
{{#set: consumed by=RXN-7835}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506]
 +
* HMDB : HMDB00283
 +
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}}
 +
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}}
 +
{{#set: common name=α-D-ribofuranose}}
 +
{{#set: molecular weight=150.131    }}
 +
{{#set: common name=α D-ribose}}
 +
{{#set: consumed by=RIBOKIN-RXN}}
 +
{{#set: reversible reaction associated=RXN-14904}}

Revision as of 13:11, 21 March 2018

Metabolite CPD-10330

  • smiles:
    • C(C1(C(C(C(O1)O)O)O))O
  • inchi key:
    • InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
  • common name:
    • α-D-ribofuranose
  • molecular weight:
    • 150.131
  • Synonym(s):
    • α D-ribose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links