Difference between revisions of "RXN1G-1053"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] == * smiles: ** CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Seminolipids Seminolipids] == * common name: ** a seminolipid * Synonym(s): ** a 1-O-alkyl-2-O-...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15566 CPD-15566] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Seminolipids Seminolipids] ==
* smiles:
+
** CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
* inchi key:
+
** InChIKey=ULOGSHZMDLRQRY-INBGBNCRSA-J
+
 
* common name:
 
* common name:
** 2-trans,4-trans-tetradecadienoyl-CoA
+
** a seminolipid
* molecular weight:
+
** 969.83   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a 1-O-alkyl-2-O-acyl-3-O-(3'-sulfo)-β-D-galactosyl-sn-glycerol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14715]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-17203]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a seminolipid}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659084 90659084]
+
{{#set: common name=a 1-O-alkyl-2-O-acyl-3-O-(3'-sulfo)-β-D-galactosyl-sn-glycerol}}
* CHEBI:
+
{{#set: reversible reaction associated=RXN-17203}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87712 87712]
+
{{#set: smiles=CCCCCCCCCC=CC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: inchi key=InChIKey=ULOGSHZMDLRQRY-INBGBNCRSA-J}}
+
{{#set: common name=2-trans,4-trans-tetradecadienoyl-CoA}}
+
{{#set: molecular weight=969.83    }}
+
{{#set: consumed by=RXN-14715}}
+

Revision as of 13:17, 21 March 2018

Metabolite Seminolipids

  • common name:
    • a seminolipid
  • Synonym(s):
    • a 1-O-alkyl-2-O-acyl-3-O-(3'-sulfo)-β-D-galactosyl-sn-glycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links