Difference between revisions of "QUINOLINATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] == * smiles: ** C(NC(N)=[N+])CCC(=O)N * inchi key: *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINEPHEN-RXN AMINEPHEN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** primary amine oxida...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-GUANIDO-BUTYRAMIDE 4-GUANIDO-BUTYRAMIDE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINEPHEN-RXN AMINEPHEN-RXN] ==
−
* smiles:
+
* direction:
−
** C(NC(N)=[N+])CCC(=O)N
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
−
** 4-guanidinobutyramide
+
** primary amine oxidase
−
* molecular weight:
+
* ec number:
−
** 145.184   
+
** [http://enzyme.expasy.org/EC/1.4.3.21 EC-1.4.3.21]
 
* Synonym(s):
 
* Synonym(s):
−
** 4-guanidinobutanamide
 
−
** 4-guanidobutanamide
 
−
** 4-guanido-butyramide
 
−
** γ-guanidinobutyramide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PHENYLETHYLAMINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[PHENYLACETALDEHYDE]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
−
* [[ARGININE-2-MONOOXYGENASE-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 oxygen[c] '''+''' 1 2-phenylethylamine[c] '''+''' 1 H2O[c] '''=>''' 1 ammonium[c] '''+''' 1 phenylacetaldehyde[c] '''+''' 1 hydrogen peroxide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-15_002920]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-15_002910]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[2PHENDEG-PWY]], phenylethylamine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=2PHENDEG-PWY 2PHENDEG-PWY]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY-5751]], phenylethanol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5751 PWY-5751]
 +
** '''1''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243936 25243936]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25265 25265]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58365 58365]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02613 R02613]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03078 C03078]
+
{{#set: common name=primary amine oxidase}}
−
{{#set: smiles=C(NC(N)=[N+])CCC(=O)N}}
+
{{#set: ec number=EC-1.4.3.21}}
−
{{#set: inchi key=InChIKey=YHVFECVVGNXFKO-UHFFFAOYSA-O}}
+
{{#set: gene associated=Ec-15_002920|Ec-15_002910}}
−
{{#set: common name=4-guanidinobutyramide}}
+
{{#set: in pathway=2PHENDEG-PWY|PWY-5751}}
−
{{#set: molecular weight=145.184    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=4-guanidinobutanamide|4-guanidobutanamide|4-guanido-butyramide|γ-guanidinobutyramide}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: consumed by=GUANIDINOBUTANAMIDE-NH3-RXN}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: produced by=ARGININE-2-MONOOXYGENASE-RXN}}
+

Revision as of 13:27, 21 March 2018

Reaction AMINEPHEN-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • primary amine oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • 2PHENDEG-PWY, phenylethylamine degradation I: 2PHENDEG-PWY
    • 2 reactions found over 2 reactions in the full pathway
  • PWY-5751, phenylethanol biosynthesis: PWY-5751
    • 1 reactions found over 8 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=QUINOLINATE&oldid=18790"