Difference between revisions of "PWY-7187"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=QUINATE-5-DEHYDROGENASE-RXN QUINATE-5-DEHYDROGENASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec numb...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=QUINATE-5-DEHYDROGENASE-RXN QUINATE-5-DEHYDROGENASE-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.1.1.24 EC-1.1.1.24] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[NAD]][c] '''+''' 1 [[QUINATE]][c] '''=>''' 1 [[DEHYDROQUINATE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] | |
| − | + | * With common name(s): | |
| − | + | ** 1 NAD+[c] '''+''' 1 L-quinate[c] '''=>''' 1 3-dehydroquinate[c] '''+''' 1 NADH[c] '''+''' 1 H+[c] | |
| − | + | ||
| − | + | == Genes associated with this reaction == | |
| − | + | == Pathways == | |
| − | * [[ | + | * [[PWY-6416]], quinate degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6416 PWY-6416] |
| − | + | ** '''2''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | == Reconstruction information == |
| − | + | * Category: [[annotation]] | |
| − | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
| − | * [[ | + | *** Tool: [[pathwaytools]] |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01872 R01872] | |
| − | + | * UNIPROT: | |
| − | + | ** [http://www.uniprot.org/uniprot/P11635 P11635] | |
| − | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.1.1.24}} |
| − | * | + | {{#set: in pathway=PWY-6416}} |
| − | ** [http://www. | + | {{#set: reconstruction category=annotation}} |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 13:29, 21 March 2018
Contents
Reaction QUINATE-5-DEHYDROGENASE-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD[c] + 1 QUINATE[c] => 1 DEHYDROQUINATE[c] + 1 NADH[c] + 1 PROTON[c]
- With common name(s):
- 1 NAD+[c] + 1 L-quinate[c] => 1 3-dehydroquinate[c] + 1 NADH[c] + 1 H+[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
