Difference between revisions of "Ec-10 005810"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * smiles: ** C(C(C1(C=CC(=CC=1)O))OC2(OC(C(C(C2O)O)O)CO))#N * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-19_001520 == * left end position: ** 1696029 * transcription direction: ** POSITIVE * right end position: ** 1701949 * centisome position: ** 28.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-19_001520 == |
− | * | + | * left end position: |
− | ** | + | ** 1696029 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1701949 |
− | * | + | * centisome position: |
− | ** | + | ** 28.405922 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0121_0057 |
− | ** | + | ** Esi0121_0057 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PROTEIN-KINASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: go-term |
+ | * Reaction: [[RXN-8443]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5381]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1696029}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1701949}} | |
− | + | {{#set: centisome position=28.405922 }} | |
− | + | {{#set: common name=Esi_0121_0057|Esi0121_0057}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN|RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:31, 21 March 2018
Gene Ec-19_001520
- left end position:
- 1696029
- transcription direction:
- POSITIVE
- right end position:
- 1701949
- centisome position:
- 28.405922
- Synonym(s):
- Esi_0121_0057
- Esi0121_0057
Reactions associated
- Reaction: PROTEIN-KINASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-8443
- Source: orthology-aragem