Difference between revisions of "PWY-5697"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETYLORNTRANSAM-RXN ACETYLORNTRANSAM-RXN] == * direction: ** REVERSIBLE * common name: ** Aminotra...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * smiles: ** [CH](=O)CC([N+])C(=O)[O-] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == |
− | * | + | * smiles: |
− | ** | + | ** [CH](=O)CC([N+])C(=O)[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-aspartate-semialdehyde |
− | * | + | * molecular weight: |
− | ** | + | ** 117.104 |
* Synonym(s): | * Synonym(s): | ||
+ | ** L-aspartic 4-semialdehyde | ||
+ | ** L-aspartate-4-semialdehyde | ||
+ | ** L-aspartate β-semialdehyde | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[HOMOSERDEHYDROG-RXN]] |
− | + | * [[DIHYDRODIPICSYN-RXN]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 15106-57-7 |
− | ** [http:// | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5287708 5287708] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * HMDB : HMDB12249 |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00441 C00441] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=537519 537519] | |
− | * | + | * BIGG : 34990 |
− | + | {{#set: smiles=[CH](=O)CC([N+])C(=O)[O-]}} | |
− | + | {{#set: inchi key=InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N}} | |
− | + | {{#set: common name=L-aspartate-semialdehyde}} | |
− | + | {{#set: molecular weight=117.104 }} | |
− | {{#set: | + | {{#set: common name=L-aspartic 4-semialdehyde|L-aspartate-4-semialdehyde|L-aspartate β-semialdehyde}} |
− | {{#set: common name= | + | {{#set: consumed by=HOMOSERDEHYDROG-RXN|DIHYDRODIPICSYN-RXN}} |
− | {{#set: | + | {{#set: reversible reaction associated=ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN}} |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 13:34, 21 March 2018
Contents
Metabolite L-ASPARTATE-SEMIALDEHYDE
- smiles:
- [CH](=O)CC([N+])C(=O)[O-]
- inchi key:
- InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N
- common name:
- L-aspartate-semialdehyde
- molecular weight:
- 117.104
- Synonym(s):
- L-aspartic 4-semialdehyde
- L-aspartate-4-semialdehyde
- L-aspartate β-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)CC([N+])C(=O)[O-" cannot be used as a page name in this wiki.