Difference between revisions of "Ec-07 007430"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * inchi key: **...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-804 PWY-804] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-804 PWY-804] ==
* smiles:
+
* taxonomic range:
** C([O-])(=O)C(=O)CC1(=CC=CC=C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
* inchi key:
+
** InChIKey=BTNMPGBKDVTSJY-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 2-oxo-3-phenylpropanoate
+
** glycolate degradation II
* molecular weight:
+
** 163.152   
+
 
* Synonym(s):
 
* Synonym(s):
** α-ketohydrocinnamic acid
+
** glycolate fermentation
** 3-phenyl-2-oxopropanoate
+
** phenylpyruvate
+
** 3-phenylpyruvate
+
** 3-phenylpyruvic acid
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[PHENYLPYRUVATE-TAUTOMERASE-RXN]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
* [[RXN-10815]]
+
* [[RXN-1744]]
== Reaction(s) known to produce the compound ==
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
* [[RXN-10814]]
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
* [[PREPHENATEDEHYDRAT-RXN]]
+
== Reaction(s) not found ==
* [[PHEAMINOTRANS-RXN]]
+
* [[RXN-15200]]
+
 
== External links  ==
 
== External links  ==
* CAS : 156-06-9
+
{{#set: taxonomic range=TAX-1239}}
* BIGG : 34111
+
{{#set: common name=glycolate degradation II}}
* PUBCHEM:
+
{{#set: common name=glycolate fermentation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4592697 4592697]
+
{{#set: reaction found=1}}
* HMDB : HMDB00205
+
{{#set: total reaction=1}}
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00166 C00166]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.3784710.html 3784710]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18005 18005]
+
* METABOLIGHTS : MTBLC18005
+
{{#set: smiles=C([O-])(=O)C(=O)CC1(=CC=CC=C1)}}
+
{{#set: inchi key=InChIKey=BTNMPGBKDVTSJY-UHFFFAOYSA-M}}
+
{{#set: common name=2-oxo-3-phenylpropanoate}}
+
{{#set: molecular weight=163.152    }}
+
{{#set: common name=α-ketohydrocinnamic acid|3-phenyl-2-oxopropanoate|phenylpyruvate|3-phenylpyruvate|3-phenylpyruvic acid}}
+
{{#set: consumed by=PHENYLPYRUVATE-TAUTOMERASE-RXN|RXN-10815}}
+
{{#set: reversible reaction associated=RXN-10814|PREPHENATEDEHYDRAT-RXN|PHEAMINOTRANS-RXN|RXN-15200}}
+

Revision as of 13:36, 21 March 2018

Pathway PWY-804

  • taxonomic range:
  • common name:
    • glycolate degradation II
  • Synonym(s):
    • glycolate fermentation

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links