Difference between revisions of "Ec-07 007430"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL-PYRUVATE PHENYL-PYRUVATE] == * smiles: ** C([O-])(=O)C(=O)CC1(=CC=CC=C1) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-804 PWY-804] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-804 PWY-804] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** glycolate degradation II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** glycolate fermentation |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
− | * [[RXN- | + | * [[RXN-1744]] |
− | + | ** 0 associated gene: | |
− | + | ** 1 reconstruction source(s) associated: | |
− | * | + | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] |
− | * | + | == Reaction(s) not found == |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: common name=glycolate degradation II}} | |
− | + | {{#set: common name=glycolate fermentation}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=1}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 13:36, 21 March 2018
Pathway PWY-804
- taxonomic range:
- common name:
- glycolate degradation II
- Synonym(s):
- glycolate fermentation
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- RXN-1744
- 0 associated gene:
- 1 reconstruction source(s) associated: