Difference between revisions of "3.1.1.64-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-1 RXN66-1] == * direction: ** LEFT-TO-RIGHT * common name: ** Catalase-peroxidase haem ** Hae...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == * smiles: ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) * inchi key: ** InChIK...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DI-H-OROTATE DI-H-OROTATE] == |
− | * | + | * smiles: |
− | ** | + | ** C1(C(=O)NC(=O)NC(C(=O)[O-])1) |
+ | * inchi key: | ||
+ | ** InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-dihydroorotate |
− | * | + | * molecular weight: |
− | + | ** 157.105 | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** dihydro-L-orotate | ||
+ | ** (S)-4,5-dihydroorotate | ||
+ | ** (S)-4,5-dihydroorotic acid | ||
+ | ** (S)-hydroorotic acid | ||
+ | ** (S)-di-H-orotate | ||
+ | ** L-dihydroorotate | ||
+ | ** 4,5-dihydro-L-orotate | ||
+ | ** L-4,5-dihydroorotate | ||
+ | ** (S)-4-pyrimidinecarboxylic acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN0-6491]] | |
− | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] | |
− | + | * [[RXN0-6554]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-6490]] | |
− | = | + | == Reaction(s) of unknown directionality == |
− | + | * [[DIHYDROOROT-RXN]] | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 5988-19-2 | |
− | + | * CAS : 155-54-4 | |
− | + | * BIGG : 34662 | |
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460289 5460289] |
− | {{#set: | + | * HMDB : HMDB00528 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00337 C00337] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4573876.html 4573876] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30864 30864] |
− | + | * METABOLIGHTS : MTBLC30864 | |
+ | {{#set: smiles=C1(C(=O)NC(=O)NC(C(=O)[O-])1)}} | ||
+ | {{#set: inchi key=InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M}} | ||
+ | {{#set: common name=(S)-dihydroorotate}} | ||
+ | {{#set: molecular weight=157.105 }} | ||
+ | {{#set: common name=dihydro-L-orotate|(S)-4,5-dihydroorotate|(S)-4,5-dihydroorotic acid|(S)-hydroorotic acid|(S)-di-H-orotate|L-dihydroorotate|4,5-dihydro-L-orotate|L-4,5-dihydroorotate|(S)-4-pyrimidinecarboxylic acid}} | ||
+ | {{#set: consumed by=RXN0-6491|DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN0-6554}} | ||
+ | {{#set: produced by=RXN0-6490}} | ||
+ | {{#set: reversible reaction associated=DIHYDROOROT-RXN}} |
Revision as of 13:38, 21 March 2018
Contents
Metabolite DI-H-OROTATE
- smiles:
- C1(C(=O)NC(=O)NC(C(=O)[O-])1)
- inchi key:
- InChIKey=UFIVEPVSAGBUSI-REOHCLBHSA-M
- common name:
- (S)-dihydroorotate
- molecular weight:
- 157.105
- Synonym(s):
- dihydro-L-orotate
- (S)-4,5-dihydroorotate
- (S)-4,5-dihydroorotic acid
- (S)-hydroorotic acid
- (S)-di-H-orotate
- L-dihydroorotate
- 4,5-dihydro-L-orotate
- L-4,5-dihydroorotate
- (S)-4-pyrimidinecarboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 5988-19-2
- CAS : 155-54-4
- BIGG : 34662
- PUBCHEM:
- HMDB : HMDB00528
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC30864
"C1(C(=O)NC(=O)NC(C(=O)[O-])1)" cannot be used as a page name in this wiki.