Difference between revisions of "HIS"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1425 CPD0-1425] == * smiles: ** CCCCCCCCCCCCCC(=O)OCC(OC(CCCCCCCCCCCCC)=O)COP([O-])(=O)[O-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1425 CPD0-1425] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCC(=O)OCC(OC(CCCCCCCCCCCCC)=O)COP([O-])(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=OZSITQMWYBNPMW-GDLZYMKVSA-L |
* common name: | * common name: | ||
| − | ** | + | ** dimyristoyl phosphatidate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 590.776 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dimyristoyl phosphatidic acid |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17021]] | ||
| + | * [[RXN-17022]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202369 25202369] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83550 83550] |
| − | + | {{#set: smiles=CCCCCCCCCCCCCC(=O)OCC(OC(CCCCCCCCCCCCC)=O)COP([O-])(=O)[O-]}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=OZSITQMWYBNPMW-GDLZYMKVSA-L}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=dimyristoyl phosphatidate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=590.776 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=dimyristoyl phosphatidic acid}} |
| − | {{#set: common name= | + | {{#set: produced by=RXN-17021|RXN-17022}} |
| − | {{#set: | + | |
| − | + | ||
Revision as of 13:58, 21 March 2018
Contents
Metabolite CPD0-1425
- smiles:
- CCCCCCCCCCCCCC(=O)OCC(OC(CCCCCCCCCCCCC)=O)COP([O-])(=O)[O-]
- inchi key:
- InChIKey=OZSITQMWYBNPMW-GDLZYMKVSA-L
- common name:
- dimyristoyl phosphatidate
- molecular weight:
- 590.776
- Synonym(s):
- dimyristoyl phosphatidic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCC(=O)OCC(OC(CCCCCCCCCCCCC)=O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.
