Difference between revisions of "CPD-8121"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7385 PWY-7385] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8121 CPD-8121] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O * common name: ** icosatetr...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7385 PWY-7385] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8121 CPD-8121] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
 
* common name:
 
* common name:
** 1,3-propanediol biosynthesis (engineered)
+
** icosatetraenoate
 +
* inchi key:
 +
** InChIKey=HQPCSDADVLFHHO-LTKCOYKYSA-M
 +
* molecular weight:
 +
** 303.464   
 
* Synonym(s):
 
* Synonym(s):
** 1,3-PDO biosynthesis
+
** (8Z,11Z,14Z,17Z)-eicosatetraenoic acid
 +
** (8Z,11Z,14Z,17Z)-eicosatetraenoate
 +
** (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate
 +
** ETA
 +
** eicosatetraenoate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''5''' reactions found over '''9''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[1.1.1.8-RXN]]
+
== Reaction(s) of unknown directionality ==
** 3 associated gene(s):
+
* [[RXN-8349_PLANTCYC]]
*** [[Ec-19_001930]]
+
*** [[Ec-19_004200]]
+
*** [[Ec-27_006990]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[6PFRUCTPHOS-RXN]]
+
** 3 associated gene(s):
+
*** [[Ec-14_003880]]
+
*** [[Ec-22_000070]]
+
*** [[Ec-12_002540]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
*** [[orthology-aragem]]
+
* [[F16ALDOLASE-RXN]]
+
** 4 associated gene(s):
+
*** [[Ec-10_004980]]
+
*** [[Ec-01_008040]]
+
*** [[Ec-10_000880]]
+
*** [[Ec-14_001680]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[GLUCOKIN-RXN]]
+
** 1 associated gene(s):
+
*** [[Ec-27_005030]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
* [[PGLUCISOM-RXN]]
+
** 3 associated gene(s):
+
*** [[Ec-24_002470]]
+
*** [[Ec-13_003530]]
+
*** [[Ec-13_003810]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-DEHYDRATASE-RXN GLYCEROL-DEHYDRATASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14965 RXN-14965]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6487 RXN0-6487]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7077 RXN0-7077]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* CHEBI:
{{#set: taxonomic range=TAX-2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71563 71563]
{{#set: common name=1,3-propanediol biosynthesis (engineered)}}
+
* HMDB : HMDB02177
{{#set: common name=1,3-PDO biosynthesis}}
+
* Wikipedia : Eicosatetraenoic_acid
{{#set: reaction found=5}}
+
* PUBCHEM:
{{#set: total reaction=9}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244091 25244091]
{{#set: completion rate=56.0}}
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O}}
 +
{{#set: common name=icosatetraenoate}}
 +
{{#set: inchi key=InChIKey=HQPCSDADVLFHHO-LTKCOYKYSA-M}}
 +
{{#set: molecular weight=303.464    }}
 +
{{#set: common name=(8Z,11Z,14Z,17Z)-eicosatetraenoic acid|(8Z,11Z,14Z,17Z)-eicosatetraenoate|(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate|ETA|eicosatetraenoate}}
 +
{{#set: reversible reaction associated=RXN-8349_PLANTCYC}}

Latest revision as of 19:27, 21 March 2018

Metabolite CPD-8121

  • smiles:
    • CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O
  • common name:
    • icosatetraenoate
  • inchi key:
    • InChIKey=HQPCSDADVLFHHO-LTKCOYKYSA-M
  • molecular weight:
    • 303.464
  • Synonym(s):
    • (8Z,11Z,14Z,17Z)-eicosatetraenoic acid
    • (8Z,11Z,14Z,17Z)-eicosatetraenoate
    • (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate
    • ETA
    • eicosatetraenoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CHEBI:
  • HMDB : HMDB02177
  • Wikipedia : Eicosatetraenoic_acid
  • PUBCHEM:
"CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O" cannot be used as a page name in this wiki.