Difference between revisions of "Ec-19 000440"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18491 CPD-18491] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Gene == Gene Ec-19_000440 == * left end position: ** 583200 * transcription direction: ** POSITIVE * right end position: ** 589888 * centisome position: ** 9.7677...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18491 CPD-18491] ==
+
== Gene Ec-19_000440 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 583200
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
+
** 589888
−
* molecular weight:
+
* centisome position:
−
** 1104.05    
+
** 9.767718    
 
* Synonym(s):
 
* Synonym(s):
−
** (6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA
+
** Esi_0054_0102
 +
** Esi0054_0102
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17113]]
+
* Reaction: [[ADPREDUCT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17112]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-aragem]]
 +
* Reaction: [[CDPREDUCT-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[GDPREDUCT-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-722]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-747]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-748]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[UDPREDUCT-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-7210]]
 +
* [[PWY-7198]]
 +
* [[PWY-7220]]
 +
* [[PWY-7184]]
 +
* [[PWY-7222]]
 +
* [[PWY0-166]]
 +
* [[PWY-7227]]
 +
* [[PWY-7226]]
 +
* [[PWY-6545]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: left end position=583200}}
−
{{#set: inchi key=InChIKey=XZYNVQDKYRHKFG-QOJZHLSOSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
+
{{#set: right end position=589888}}
−
{{#set: molecular weight=1104.05   }}
+
{{#set: centisome position=9.767718   }}
−
{{#set: common name=(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}}
+
{{#set: common name=Esi_0054_0102|Esi0054_0102}}
−
{{#set: consumed by=RXN-17113}}
+
{{#set: reaction associated=ADPREDUCT-RXN|CDPREDUCT-RXN|GDPREDUCT-RXN|RIBONUCLEOSIDE-DIP-REDUCTI-RXN|RIBONUCLEOSIDE-DIP-REDUCTII-RXN|RXN0-722|RXN0-747|RXN0-748|UDPREDUCT-RXN}}
−
{{#set: produced by=RXN-17112}}
+
{{#set: pathway associated=PWY-7210|PWY-7198|PWY-7220|PWY-7184|PWY-7222|PWY0-166|PWY-7227|PWY-7226|PWY-6545}}

Latest revision as of 19:29, 21 March 2018

Gene Ec-19_000440

  • left end position:
    • 583200
  • transcription direction:
    • POSITIVE
  • right end position:
    • 589888
  • centisome position:
    • 9.767718
  • Synonym(s):
    • Esi_0054_0102
    • Esi0054_0102

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_000440&oldid=27288"