Difference between revisions of "PWY-7318"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] == * smiles: ** C(=O)([O-])CCCCCCCC=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7318 PWY-7318] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTADEC-9-ENE-118-DIOIC-ACID OCTADEC-9-ENE-118-DIOIC-ACID] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7318 PWY-7318] ==
* smiles:
+
* taxonomic range:
** C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L
+
 
* common name:
 
* common name:
** α,ω-9Z-octadecenedioate
+
** dTDP-3-acetamido-3,6-dideoxy-α-D-glucose biosynthesis
* molecular weight:
+
** 310.433   
+
 
* Synonym(s):
 
* Synonym(s):
** α,ω-9Z-octadecenedioic acid
+
** dTDP-3-acetamido-3,6-dideoxy-α-D-glucopyranose biosynthesis
** 1,18-9Z-octadecenedioic acid
+
** octadecenedioate
+
** 18-carboxyl oleate
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-16418]]
+
'''1''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[DTDPGLUCDEHYDRAT-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-27_005770]]
 +
*** [[Ec-01_007350]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=DTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12810 RXN-12810]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12840 RXN-12840]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14735 RXN-14735]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657642 90657642]
+
{{#set: common name=dTDP-3-acetamido-3,6-dideoxy-α-D-glucose biosynthesis}}
{{#set: smiles=C(=O)([O-])CCCCCCCC=CCCCCCCCC(=O)[O-]}}
+
{{#set: common name=dTDP-3-acetamido-3,6-dideoxy-α-D-glucopyranose biosynthesis}}
{{#set: inchi key=InChIKey=SBLKVIQSIHEQOF-UPHRSURJSA-L}}
+
{{#set: reaction found=1}}
{{#set: common name=α,ω-9Z-octadecenedioate}}
+
{{#set: total reaction=5}}
{{#set: molecular weight=310.433    }}
+
{{#set: completion rate=20.0}}
{{#set: common name=α,ω-9Z-octadecenedioic acid|1,18-9Z-octadecenedioic acid|octadecenedioate|18-carboxyl oleate}}
+
{{#set: consumed by=RXN-16418}}
+

Latest revision as of 19:30, 21 March 2018

Pathway PWY-7318

  • taxonomic range:
  • common name:
    • dTDP-3-acetamido-3,6-dideoxy-α-D-glucose biosynthesis
  • Synonym(s):
    • dTDP-3-acetamido-3,6-dideoxy-α-D-glucopyranose biosynthesis

Reaction(s) found

1 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links