Difference between revisions of "CPD-11281"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-237 CPD-237] == * smiles: ** C1(=C(CC(N)=O)C2(=CC=CC=C(N1)2)) * inchi key: ** InChIKey=ZOAM...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M |
* common name: | * common name: | ||
| − | ** | + | ** S-sulfanylglutathione |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 338.373 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** GSSH |
| − | ** | + | ** glutathione-sulfide |
| − | ** | + | ** glutathione persulfide |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15348]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-10851]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878477 46878477] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58905 58905] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C17267 C17267] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: common name=S-sulfanylglutathione}} |
| − | {{#set: common name= | + | {{#set: molecular weight=338.373 }} |
| − | {{#set: | + | {{#set: common name=GSSH|glutathione-sulfide|glutathione persulfide}} |
| + | {{#set: produced by=RXN-15348}} | ||
| + | {{#set: reversible reaction associated=RXN-10851}} | ||
Latest revision as of 19:31, 21 March 2018
Contents
Metabolite CPD-11281
- smiles:
- C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- inchi key:
- InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
- common name:
- S-sulfanylglutathione
- molecular weight:
- 338.373
- Synonym(s):
- GSSH
- glutathione-sulfide
- glutathione persulfide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
